| Name | Hexaaminecobalt(III) chloride |
| Synonyms | cobalt azanide hexamminecobalttrichloride hexaamminecobalt trichloride Hexamminecobalt(III) chloride Hexaaminecobalt(III) chloride Hexaamine cobalt(III) chloride Hexaamminecobalt (III) chloride Hexaamminecobaltchlorideorangepowder Hexamminecobalt(III) chloride solution Hexammine cobalt(III) chloride,Cobalt hexammine trichloride, Hexaamminecobalt trichloride Hexaamminecobalt(III) chloride,Cobalt hexammine trichloride, Hexaamminecobalt trichloride |
| CAS | 10534-89-1 |
| EINECS | 234-103-9 |
| InChI | InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
| InChIKey | JXBGZYGSWFSYFI-UHFFFAOYSA-K |
| Molecular Formula | Cl3CoH18N6 |
| Molar Mass | 267.48 |
| Density | 1.71g/mLat 25°C(lit.) |
| Melting Point | 217°C(lit.) |
| Water Solubility | Soluble in ammonia and water. |
| Solubility | Soluble in ammonia. |
| Appearance | Orange to red to brown powder or crystal |
| Specific Gravity | 1.71 |
| Color | Orange to orange-brown |
| Exposure Limit | ACGIH: TWA 0.02 mg/m3 |
| Merck | 14,4675 |
| Storage Condition | room temp |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| MDL | MFCD00036304 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | UN 2811 6.1/PG III |
| WGK Germany | 3 |
| TSCA | Yes |
| Hazard Class | 6.1 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |